Products 2226301-24-0
CAS 2226301-24-0 is the registry number for 5-((2-(2,6-Dioxopiperidin-3-yl)-1,3-dioxoisoindolin-5-yl)oxy)pentanoic acid, 95%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg.
5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentanoic acid (CAS 2226301-24-0) is a chemical compound with the molecular formula C18H18N2O7 and a molecular weight of 374.3 g/mol. IUPAC name: 5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentanoic acid. InChIKey: OGCVLNRVXVCTLP-UHFFFAOYSA-N.
| Molecular formula | C18H18N2O7 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 5-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]oxypentanoic acid |
| InChIKey | OGCVLNRVXVCTLP-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)OCCCCC(=O)O |
Computed by PubChem (NCBI)