CAS 2226493-66-7 is the registry number for 3-Chloro-2-isobutyryl-5,5-dimethylcyclohex-2-en-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-5,5-dimethyl-2-(2-methylpropanoyl)cyclohex-2-en-1-one (CAS 2226493-66-7) is a chemical compound with the molecular formula C12H17ClO2 and a molecular weight of 228.71 g/mol. IUPAC name: 3-chloro-5,5-dimethyl-2-(2-methylpropanoyl)cyclohex-2-en-1-one. InChIKey: USCBPNOSGOJTHT-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO2 |
|---|---|
| Molecular weight | 228.71 g/mol |
| IUPAC name | 3-chloro-5,5-dimethyl-2-(2-methylpropanoyl)cyclohex-2-en-1-one |
| InChIKey | USCBPNOSGOJTHT-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)C1=C(CC(CC1=O)(C)C)Cl |
Computed by PubChem (NCBI)