Products 42501-29-1
CAS 42501-29-1 is the registry number for (3-Chloro-adamantan-1-yl)-acetic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-(3-chloro-1-adamantyl)acetic acid (CAS 42501-29-1) is a chemical compound with the molecular formula C12H17ClO2 and a molecular weight of 228.71 g/mol. IUPAC name: 2-(3-chloro-1-adamantyl)acetic acid. InChIKey: JLHRDMZSPPRYGL-UHFFFAOYSA-N.
| Molecular formula | C12H17ClO2 |
|---|---|
| Molecular weight | 228.71 g/mol |
| IUPAC name | 2-(3-chloro-1-adamantyl)acetic acid |
| InChIKey | JLHRDMZSPPRYGL-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1CC(C2)(C3)Cl)CC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
(3-Chloro-adamantan-1-yl)-acetic acid, 2-(3-chloroadamantan-1-yl)acetic acid, 2-(3-chloro-1-adamantyl)acetic acid, (3-chloroadamantan-1-yl)acetic acid, Enamine_005669, 3-chloro-1-adamantyl-acetic acid, JLHRDMZSPPRYGL-UHFFFAOYSA-N, 1-carboxymethyl-3-chloroadamantane, [(5R,7S)-3-chlorotricyclo[3.3.1.1~3,7~]dec-1-yl]acetic acid