Products 2227-61-4
CAS 2227-61-4 is the registry number for 4-Phenyl-2-(p-tolyl)thiazole, 99%, 99%. Offered by: Chemat. Available pack sizes: 1g, 5g.
2-(4-methylphenyl)-4-phenyl-1,3-thiazole (CAS 2227-61-4) is a chemical compound with the molecular formula C16H13NS and a molecular weight of 251.3 g/mol. IUPAC name: 2-(4-methylphenyl)-4-phenyl-1,3-thiazole. InChIKey: HJOFTDPFWFTGNO-UHFFFAOYSA-N.
| Molecular formula | C16H13NS |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | 2-(4-methylphenyl)-4-phenyl-1,3-thiazole |
| InChIKey | HJOFTDPFWFTGNO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=CS2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)