CAS 3755-83-7 appears in our catalog under these names: 2–Methyl–4,5–diphenylthiazole, 2-Methyl-4,5-diphenylthiazole, >97.0%(GC), 2-Methyl-4,5-diphenylthiazole 98%, 4,5-DIPHENYL-2-METHYLTHIAZOLE, 2-Methyl-4,5-diphenylthiazole, 98%. Offered by: GLPBio, TCI, Ambeed, Sigma-Aldrich, Fluorochem. Available pack sizes: 25g, 5g, 250mg, 1g.
2-methyl-4,5-diphenyl-1,3-thiazole (CAS 3755-83-7) is a chemical compound with the molecular formula C16H13NS and a molecular weight of 251.3 g/mol. IUPAC name: 2-methyl-4,5-diphenyl-1,3-thiazole. InChIKey: ZFYWCVZNRMSXBT-UHFFFAOYSA-N.
| Molecular formula | C16H13NS |
|---|---|
| Molecular weight | 251.3 g/mol |
| IUPAC name | 2-methyl-4,5-diphenyl-1,3-thiazole |
| InChIKey | ZFYWCVZNRMSXBT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=C(S1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)