CAS 2227105-14-6 is the registry number for 1,3-Dibromo-2-(phenoxymethyl)benzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dibromo-2-(phenoxymethyl)benzene (CAS 2227105-14-6) is a chemical compound with the molecular formula C13H10Br2O and a molecular weight of 342.02 g/mol. IUPAC name: 1,3-dibromo-2-(phenoxymethyl)benzene. InChIKey: SHNGLDRUTNTYDP-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2O |
|---|---|
| Molecular weight | 342.02 g/mol |
| IUPAC name | 1,3-dibromo-2-(phenoxymethyl)benzene |
| InChIKey | SHNGLDRUTNTYDP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCC2=C(C=CC=C2Br)Br |
Computed by PubChem (NCBI)