CAS 66175-40-4 appears in our catalog under these names: 3,4'-DIBROMO-4-METHOXY-1,1'-BIPHENYL, 98%, 3,4'-Dibromo-4-methoxy-1,1'-biphenyl, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-4-(4-bromophenyl)-1-methoxybenzene (CAS 66175-40-4) is a chemical compound with the molecular formula C13H10Br2O and a molecular weight of 342.02 g/mol. IUPAC name: 2-bromo-4-(4-bromophenyl)-1-methoxybenzene. InChIKey: HWCBENKXSARKGK-UHFFFAOYSA-N.
| Molecular formula | C13H10Br2O |
|---|---|
| Molecular weight | 342.02 g/mol |
| IUPAC name | 2-bromo-4-(4-bromophenyl)-1-methoxybenzene |
| InChIKey | HWCBENKXSARKGK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)