Products 2227110-54-3
CAS 2227110-54-3 appears in our catalog under these names: 3-IN-PP1, 3–IN–PP1, 3-IN-PP1, 99.37%. Offered by: TargetMol, GLPBio, MedChemExpress. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 25 mg, 100 mg, 10 mg, 50 mg.
1-tert-butyl-3-(1H-indol-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine (CAS 2227110-54-3) is a chemical compound with the molecular formula C17H18N6 and a molecular weight of 306.4 g/mol. IUPAC name: 1-tert-butyl-3-(1H-indol-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: RBZLXANOQRQGTN-UHFFFAOYSA-N.
| Molecular formula | C17H18N6 |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1-tert-butyl-3-(1H-indol-3-yl)pyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | RBZLXANOQRQGTN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1C2=NC=NC(=C2C(=N1)C3=CNC4=CC=CC=C43)N |
Computed by PubChem (NCBI)