CAS 2227198-42-5 is the registry number for tert-Butyl (R)-6-(hydroxymethyl)-5-azaspiro(2.4)heptane-5-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl (6R)-6-(hydroxymethyl)-5-azaspiro[2.4]heptane-5-carboxylate (CAS 2227198-42-5) is a chemical compound with the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. IUPAC name: tert-butyl (6R)-6-(hydroxymethyl)-5-azaspiro[2.4]heptane-5-carboxylate. InChIKey: MSSVPAHZRUMIBA-SECBINFHSA-N.
| Molecular formula | C12H21NO3 |
|---|---|
| Molecular weight | 227.30 g/mol |
| IUPAC name | tert-butyl (6R)-6-(hydroxymethyl)-5-azaspiro[2.4]heptane-5-carboxylate |
| InChIKey | MSSVPAHZRUMIBA-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)C[C@@H]1CO |
Computed by PubChem (NCBI)