CAS 2227199-19-9 is the registry number for (1R,6S)-4-Methyl-4,7-diazabicyclo(4.2.0)octane dihydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 100mg, 250mg, 1g.
(1R,6S)-3-methyl-3,8-diazabicyclo[4.2.0]octane;dihydrochloride (CAS 2227199-19-9) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (1R,6S)-3-methyl-3,8-diazabicyclo[4.2.0]octane;dihydrochloride. InChIKey: MMEHTIGZGIDNOI-JFYKYWLVSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (1R,6S)-3-methyl-3,8-diazabicyclo[4.2.0]octane;dihydrochloride |
| InChIKey | MMEHTIGZGIDNOI-JFYKYWLVSA-N |
| SMILES | CN1CC[C@H]2CN[C@H]2C1.Cl.Cl |
Computed by PubChem (NCBI)