CAS 2227199-30-4 is the registry number for (1R,2R,5R)-8-Azabicyclo(3.2.1)octane-2-carboxylic acid hydrochloride, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 10g, 100mg.
(1R,2R,5R)-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride (CAS 2227199-30-4) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1R,2R,5R)-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride. InChIKey: LIBOXYFYULDXLA-RYLOHDEPSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (1R,2R,5R)-8-azabicyclo[3.2.1]octane-2-carboxylic acid;hydrochloride |
| InChIKey | LIBOXYFYULDXLA-RYLOHDEPSA-N |
| SMILES | C1C[C@H]([C@H]2CC[C@@H]1N2)C(=O)O.Cl |
Computed by PubChem (NCBI)