CAS 2227206-57-5 appears in our catalog under these names: 1-tert-Butyl 3-methyl 5-(trifluoromethyl)piperidine-1,3-dicarboxylate, 97%, 97%, 1-tert-Butyl 3-methyl 5-(trifluoromethyl)piperidine-1,3-dicarboxylate, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
1-O-tert-butyl 3-O-methyl 5-(trifluoromethyl)piperidine-1,3-dicarboxylate (CAS 2227206-57-5) is a chemical compound with the molecular formula C13H20F3NO4 and a molecular weight of 311.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 5-(trifluoromethyl)piperidine-1,3-dicarboxylate. InChIKey: NONJHXVASFECAD-UHFFFAOYSA-N.
| Molecular formula | C13H20F3NO4 |
|---|---|
| Molecular weight | 311.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 5-(trifluoromethyl)piperidine-1,3-dicarboxylate |
| InChIKey | NONJHXVASFECAD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(CC(C1)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)