CAS 2243222-07-1 appears in our catalog under these names: Rel-1-(tert-butyl) 3-methyl (3R,5S)-5-(trifluoromethyl)piperidine-1,3-dicarboxylate, 97%, O1-tert-butyl O3-methyl cis-5-(trifluoromethyl)piperidine-1,3-dicarboxylate, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 100mg, 250mg, 500mg.
1-O-tert-butyl 3-O-methyl (3R,5S)-5-(trifluoromethyl)piperidine-1,3-dicarboxylate (CAS 2243222-07-1) is a chemical compound with the molecular formula C13H20F3NO4 and a molecular weight of 311.30 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R,5S)-5-(trifluoromethyl)piperidine-1,3-dicarboxylate. InChIKey: NONJHXVASFECAD-BDAKNGLRSA-N.
| Molecular formula | C13H20F3NO4 |
|---|---|
| Molecular weight | 311.30 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R,5S)-5-(trifluoromethyl)piperidine-1,3-dicarboxylate |
| InChIKey | NONJHXVASFECAD-BDAKNGLRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H](C1)C(F)(F)F)C(=O)OC |
Computed by PubChem (NCBI)