Products 2227245-63-6
CAS 2227245-63-6 is the registry number for tert-Butyl 4-(6-aminopyridin-3-yl)benzoate, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
Tert-butyl 4-(6-amino-3-pyridinyl)benzoate (CAS 2227245-63-6) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: tert-butyl 4-(6-amino-3-pyridinyl)benzoate. InChIKey: IPCHEVNEQSVUTD-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | tert-butyl 4-(6-amino-3-pyridinyl)benzoate |
| InChIKey | IPCHEVNEQSVUTD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=C(C=C1)C2=CN=C(C=C2)N |
Computed by PubChem (NCBI)