CAS 2227716-59-6 is the registry number for rac-(3R,4S)-1-Benzyl-4-(1-methyl-1H-pyrazol-5-yl)pyrrolidin-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3S,4R)-1-benzyl-4-(2-methylpyrazol-3-yl)pyrrolidin-3-amine (CAS 2227716-59-6) is a chemical compound with the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. IUPAC name: (3S,4R)-1-benzyl-4-(2-methylpyrazol-3-yl)pyrrolidin-3-amine. InChIKey: UEFTZSZOWHIMLW-ZIAGYGMSSA-N.
| Molecular formula | C15H20N4 |
|---|---|
| Molecular weight | 256.35 g/mol |
| IUPAC name | (3S,4R)-1-benzyl-4-(2-methylpyrazol-3-yl)pyrrolidin-3-amine |
| InChIKey | UEFTZSZOWHIMLW-ZIAGYGMSSA-N |
| SMILES | CN1C(=CC=N1)[C@@H]2CN(C[C@H]2N)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)