CAS 2228087-89-4 is the registry number for tert-Butyl 4-(1-aminoethyl)-4-hydroxypiperidine-1-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 4-(1-aminoethyl)-4-hydroxypiperidine-1-carboxylate;hydrochloride (CAS 2228087-89-4) is a chemical compound with the molecular formula C12H25ClN2O3 and a molecular weight of 280.79 g/mol. IUPAC name: tert-butyl 4-(1-aminoethyl)-4-hydroxypiperidine-1-carboxylate;hydrochloride. InChIKey: GTHCESTXYVCZID-UHFFFAOYSA-N.
| Molecular formula | C12H25ClN2O3 |
|---|---|
| Molecular weight | 280.79 g/mol |
| IUPAC name | tert-butyl 4-(1-aminoethyl)-4-hydroxypiperidine-1-carboxylate;hydrochloride |
| InChIKey | GTHCESTXYVCZID-UHFFFAOYSA-N |
| SMILES | CC(C1(CCN(CC1)C(=O)OC(C)(C)C)O)N.Cl |
Computed by PubChem (NCBI)