CAS 56610-13-0 appears in our catalog under these names: H–Leu–Gly–OtBu · HCl, H-Leu-Gly-OtBu·HCl. Offered by: GLPBio, Biosynth. Available pack sizes: 1g, 250mg, 500mg, 1000mg, 2000mg.
Tert-butyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetate;hydrochloride (CAS 56610-13-0) is a chemical compound with the molecular formula C12H25ClN2O3 and a molecular weight of 280.79 g/mol. IUPAC name: tert-butyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetate;hydrochloride. InChIKey: UTYHNRBLBHNQRL-FVGYRXGTSA-N.
| Molecular formula | C12H25ClN2O3 |
|---|---|
| Molecular weight | 280.79 g/mol |
| IUPAC name | tert-butyl 2-[[(2S)-2-amino-4-methylpentanoyl]amino]acetate;hydrochloride |
| InChIKey | UTYHNRBLBHNQRL-FVGYRXGTSA-N |
| SMILES | CC(C)C[C@@H](C(=O)NCC(=O)OC(C)(C)C)N.Cl |
Computed by PubChem (NCBI)