Products 2228242-58-6
CAS 2228242-58-6 is the registry number for 2-{1-((tert-Butoxy)carbonyl)-5,5-dimethylpiperidin-2-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[5,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]acetic acid (CAS 2228242-58-6) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 2-[5,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]acetic acid. InChIKey: UTDKQQMONBSVCQ-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 2-[5,5-dimethyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-2-yl]acetic acid |
| InChIKey | UTDKQQMONBSVCQ-UHFFFAOYSA-N |
| SMILES | CC1(CCC(N(C1)C(=O)OC(C)(C)C)CC(=O)O)C |
Computed by PubChem (NCBI)