Products 2228273-70-7
CAS 2228273-70-7 is the registry number for 3-(6-Methoxy-3-pyridinyl)-1-methyl-1H-pyrazol-5-amine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
3-(6-methoxy-3-pyridinyl)-1-methylpyrazol-5-amine (CAS 2228273-70-7) is a chemical compound with the molecular formula C10H12N4O and a molecular weight of 204.23 g/mol. IUPAC name: 3-(6-methoxy-3-pyridinyl)-1-methylpyrazol-5-amine. InChIKey: GFDSKQHQKMEZHT-UHFFFAOYSA-N.
| Molecular formula | C10H12N4O |
|---|---|
| Molecular weight | 204.23 g/mol |
| IUPAC name | 3-(6-methoxy-3-pyridinyl)-1-methylpyrazol-5-amine |
| InChIKey | GFDSKQHQKMEZHT-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CN=C(C=C2)OC)N |
Computed by PubChem (NCBI)