CAS 2228475-70-3 is the registry number for Dopamine Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2-chloro-1-hydroxyethyl)benzene-1,2-diol (CAS 2228475-70-3) is a chemical compound with the molecular formula C8H9ClO3 and a molecular weight of 188.61 g/mol. IUPAC name: 3-(2-chloro-1-hydroxyethyl)benzene-1,2-diol. InChIKey: MMLLGORCLLZXSJ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClO3 |
|---|---|
| Molecular weight | 188.61 g/mol |
| IUPAC name | 3-(2-chloro-1-hydroxyethyl)benzene-1,2-diol |
| InChIKey | MMLLGORCLLZXSJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)O)C(CCl)O |
Computed by PubChem (NCBI)