Products 98490-89-2

CAS 98490-89-2 is the registry number for Methyl 4-(chloromethyl)-5-methylfuran-2-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-(chloromethyl)-5-methylfuran-2-carboxylate (CAS 98490-89-2) is a chemical compound with the molecular formula C8H9ClO3 and a molecular weight of 188.61 g/mol. IUPAC name: methyl 4-(chloromethyl)-5-methylfuran-2-carboxylate. InChIKey: XSQLZOXWRIQRDI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H9ClO3
Molecular weight188.61 g/mol
IUPAC namemethyl 4-(chloromethyl)-5-methylfuran-2-carboxylate
InChIKeyXSQLZOXWRIQRDI-UHFFFAOYSA-N
SMILESCC1=C(C=C(O1)C(=O)OC)CCl

Computed by PubChem (NCBI)