Products 2228488-17-1
CAS 2228488-17-1 is the registry number for tert-Butyl (4-(fluorosulfonyl)phenyl)carbamate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(4-fluorosulfonylphenyl)carbamate (CAS 2228488-17-1) is a chemical compound with the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. IUPAC name: tert-butyl N-(4-fluorosulfonylphenyl)carbamate. InChIKey: MDHLFSMNWLGTSW-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO4S |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | tert-butyl N-(4-fluorosulfonylphenyl)carbamate |
| InChIKey | MDHLFSMNWLGTSW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)S(=O)(=O)F |
Computed by PubChem (NCBI)