Products 926245-18-3
CAS 926245-18-3 appears in our catalog under these names: 3-(tert-Butylsulfamoyl)-4-fluorobenzoic acid, 3-(tert-Butylsulfamoyl)-4-fluorobenzoic acid, 95%, 3-[(tert-Butylamino)sulfonyl]-4-fluorobenzoic acid, 95%. Offered by: Biosynth, AmBeed, Combi-blocks. Available pack sizes: 0,5g, 5g, 10g, 1g, 250mg.
3-(tert-butylsulfamoyl)-4-fluorobenzoic acid (CAS 926245-18-3) is a chemical compound with the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. IUPAC name: 3-(tert-butylsulfamoyl)-4-fluorobenzoic acid. InChIKey: IVIQFJGPVKZBKX-UHFFFAOYSA-N.
| Molecular formula | C11H14FNO4S |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 3-(tert-butylsulfamoyl)-4-fluorobenzoic acid |
| InChIKey | IVIQFJGPVKZBKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NS(=O)(=O)C1=C(C=CC(=C1)C(=O)O)F |
Computed by PubChem (NCBI)