CAS 22285-22-9 is the registry number for 4-Amino-3-((4-chlorobenzyl)thio)-6-methyl-1,2,4-triazin-5(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-3-[(4-chlorophenyl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-one (CAS 22285-22-9) is a chemical compound with the molecular formula C11H11ClN4OS and a molecular weight of 282.75 g/mol. IUPAC name: 4-amino-3-[(4-chlorophenyl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-one. InChIKey: ZQCPYIPFHLTWTB-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4OS |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 4-amino-3-[(4-chlorophenyl)methylsulfanyl]-6-methyl-1,2,4-triazin-5-one |
| InChIKey | ZQCPYIPFHLTWTB-UHFFFAOYSA-N |
| SMILES | CC1=NN=C(N(C1=O)N)SCC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)