CAS 496021-77-3 is the registry number for 2-(5-(2-Chlorobenzyl)-4-oxo-4,5-dihydro-1,3-thiazol-2-yl)guanidine. Offered by: TRC. Available pack sizes: 500mg.
1-[5-[(2-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]guanidine (CAS 496021-77-3) is a chemical compound with the molecular formula C11H11ClN4OS and a molecular weight of 282.75 g/mol. IUPAC name: 1-[5-[(2-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]guanidine. InChIKey: ANTZKNUTIAZRAC-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN4OS |
|---|---|
| Molecular weight | 282.75 g/mol |
| IUPAC name | 1-[5-[(2-chlorophenyl)methyl]-4-oxo-1,3-thiazolidin-2-ylidene]guanidine |
| InChIKey | ANTZKNUTIAZRAC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2C(=O)NC(=NC(=N)N)S2)Cl |
Computed by PubChem (NCBI)