CAS 22288-77-3 is the registry number for 2,5-Diamino-2,3-dihydrothiazolo(4,5-d)pyrimidine-7-(6H)-one. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
2,5-diamino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one (CAS 22288-77-3) is a chemical compound with the molecular formula C5H5N5OS and a molecular weight of 183.19 g/mol. IUPAC name: 2,5-diamino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one. InChIKey: QWAUZOMMNINGON-UHFFFAOYSA-N.
| Molecular formula | C5H5N5OS |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 2,5-diamino-6H-[1,3]thiazolo[4,5-d]pyrimidin-7-one |
| InChIKey | QWAUZOMMNINGON-UHFFFAOYSA-N |
| SMILES | C12=C(N=C(NC1=O)N)N=C(S2)N |
Computed by PubChem (NCBI)