CAS 28128-40-7 is the registry number for 2-Amino-6-hydroxy-8-mercaptopurine, 97%. Offered by: Thermo Scientific (Acros). Available pack sizes: 5g, 25g.
2-amino-8-sulfanylidene-7,9-dihydro-1H-purin-6-one (CAS 28128-40-7) is a chemical compound with the molecular formula C5H5N5OS and a molecular weight of 183.19 g/mol. IUPAC name: 2-amino-8-sulfanylidene-7,9-dihydro-1H-purin-6-one. InChIKey: JHEKNTQSGTVPAO-UHFFFAOYSA-N.
| Molecular formula | C5H5N5OS |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 2-amino-8-sulfanylidene-7,9-dihydro-1H-purin-6-one |
| InChIKey | JHEKNTQSGTVPAO-UHFFFAOYSA-N |
| SMILES | C12=C(NC(=S)N1)N=C(NC2=O)N |
Computed by PubChem (NCBI)