Products 2228821-71-2
CAS 2228821-71-2 is the registry number for tert-butyl 4-(azetidin-3-yl)-1H-imidazole-1-carboxylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 4-(azetidin-3-yl)imidazole-1-carboxylate (CAS 2228821-71-2) is a chemical compound with the molecular formula C11H17N3O2 and a molecular weight of 223.27 g/mol. IUPAC name: tert-butyl 4-(azetidin-3-yl)imidazole-1-carboxylate. InChIKey: NLGWPUJQKFEUQK-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | tert-butyl 4-(azetidin-3-yl)imidazole-1-carboxylate |
| InChIKey | NLGWPUJQKFEUQK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=C(N=C1)C2CNC2 |
Computed by PubChem (NCBI)