Products 2228847-12-7
CAS 2228847-12-7 is the registry number for Kanglexin, 99.65%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 50 mg, 25 mg, 10mM/1mL, 100 mg.
4-O-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl) 1-O-ethyl butanedioate (CAS 2228847-12-7) is a chemical compound with the molecular formula C21H18O8 and a molecular weight of 398.4 g/mol. IUPAC name: 4-O-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl) 1-O-ethyl butanedioate. InChIKey: BPCWYLYZWFBKMI-UHFFFAOYSA-N.
| Molecular formula | C21H18O8 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | 4-O-(4,5-dihydroxy-7-methyl-9,10-dioxoanthracen-2-yl) 1-O-ethyl butanedioate |
| InChIKey | BPCWYLYZWFBKMI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CCC(=O)OC1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)C=C(C=C3O)C |
Computed by PubChem (NCBI)