CAS 3682-04-0 appears in our catalog under these names: Naringenin triacetate, Naringenin triacetate, 99.90% ,, 99.90% ,, Naringenin triacetate, 99.65%. Offered by: Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 1mg, 100mg, 200mg, 5 mg.
[4-(5,7-diacetyloxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] acetate (CAS 3682-04-0) is a chemical compound with the molecular formula C21H18O8 and a molecular weight of 398.4 g/mol. IUPAC name: [4-(5,7-diacetyloxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] acetate. InChIKey: HQZXCNZZVRAEPO-UHFFFAOYSA-N.
| Molecular formula | C21H18O8 |
|---|---|
| Molecular weight | 398.4 g/mol |
| IUPAC name | [4-(5,7-diacetyloxy-4-oxo-2,3-dihydrochromen-2-yl)phenyl] acetate |
| InChIKey | HQZXCNZZVRAEPO-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C2CC(=O)C3=C(O2)C=C(C=C3OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)