Products 2229173-86-6
CAS 2229173-86-6 appears in our catalog under these names: 2–methyl–2–(3–(trifluoromethoxy)phenyl)propan–1–ol, 2-methyl-2-[3-(trifluoromethoxy)phenyl]propan-1-ol. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 1g, 250mg.
2-methyl-2-[3-(trifluoromethoxy)phenyl]propan-1-ol (CAS 2229173-86-6) is a chemical compound with the molecular formula C11H13F3O2 and a molecular weight of 234.21 g/mol. IUPAC name: 2-methyl-2-[3-(trifluoromethoxy)phenyl]propan-1-ol. InChIKey: IXXAGIMCRJDRTF-UHFFFAOYSA-N.
| Molecular formula | C11H13F3O2 |
|---|---|
| Molecular weight | 234.21 g/mol |
| IUPAC name | 2-methyl-2-[3-(trifluoromethoxy)phenyl]propan-1-ol |
| InChIKey | IXXAGIMCRJDRTF-UHFFFAOYSA-N |
| SMILES | CC(C)(CO)C1=CC(=CC=C1)OC(F)(F)F |
Computed by PubChem (NCBI)