CAS 2229238-42-8 appears in our catalog under these names: 1-(4,6-Dichloropyridin-3-yl)-2,2-difluoroethan-1-one, 98%, 1-(4,6-Dichloropyridin-3-yl)-2,2-difluoroethan-1-one, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg.
1-(4,6-dichloro-3-pyridinyl)-2,2-difluoroethanone (CAS 2229238-42-8) is a chemical compound with the molecular formula C7H3Cl2F2NO and a molecular weight of 226.00 g/mol. IUPAC name: 1-(4,6-dichloro-3-pyridinyl)-2,2-difluoroethanone. InChIKey: KSBUSGWILVKNDW-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F2NO |
|---|---|
| Molecular weight | 226.00 g/mol |
| IUPAC name | 1-(4,6-dichloro-3-pyridinyl)-2,2-difluoroethanone |
| InChIKey | KSBUSGWILVKNDW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CN=C1Cl)C(=O)C(F)F)Cl |
Computed by PubChem (NCBI)