CAS 2924650-95-1 is the registry number for 2-(2,6-Dichloropyridin-4-yl)-2,2-difluoroacetaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroacetaldehyde (CAS 2924650-95-1) is a chemical compound with the molecular formula C7H3Cl2F2NO and a molecular weight of 226.00 g/mol. IUPAC name: 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroacetaldehyde. InChIKey: KPLVDRLJXDVZOR-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl2F2NO |
|---|---|
| Molecular weight | 226.00 g/mol |
| IUPAC name | 2-(2,6-dichloro-4-pyridinyl)-2,2-difluoroacetaldehyde |
| InChIKey | KPLVDRLJXDVZOR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(C=O)(F)F |
Computed by PubChem (NCBI)