Products 2229238-53-1

CAS 2229238-53-1 is the registry number for 2,2-Difluoro-3-methylpentanoic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,2-difluoro-3-methylpentanoic acid (CAS 2229238-53-1) is a chemical compound with the molecular formula C6H10F2O2 and a molecular weight of 152.14 g/mol. IUPAC name: 2,2-difluoro-3-methylpentanoic acid. InChIKey: KGXOFXWQHQUOAB-UHFFFAOYSA-N.

Identity
Molecular formulaC6H10F2O2
Molecular weight152.14 g/mol
IUPAC name2,2-difluoro-3-methylpentanoic acid
InChIKeyKGXOFXWQHQUOAB-UHFFFAOYSA-N
SMILESCCC(C)C(C(=O)O)(F)F

Computed by PubChem (NCBI)