Products 2229448-00-2
CAS 2229448-00-2 is the registry number for 1-(3-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)phenyl)cyclobutane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]cyclobutane-1-carboxylic acid (CAS 2229448-00-2) is a chemical compound with the molecular formula C26H23NO4 and a molecular weight of 413.5 g/mol. IUPAC name: 1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]cyclobutane-1-carboxylic acid. InChIKey: QVUYXZYAGWFANH-UHFFFAOYSA-N.
| Molecular formula | C26H23NO4 |
|---|---|
| Molecular weight | 413.5 g/mol |
| IUPAC name | 1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]cyclobutane-1-carboxylic acid |
| InChIKey | QVUYXZYAGWFANH-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C2=CC(=CC=C2)NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35)C(=O)O |
Computed by PubChem (NCBI)