CAS 2230013-05-3 is the registry number for rel-(1S,3R)-3-Amino-1-(trifluoromethyl)cyclopentan-1-ol hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 250mg, 1g.
Trans-(1S,3R)-3-amino-1-(trifluoromethyl)cyclopentan-1-ol;hydrochloride (CAS 2230013-05-3) is a chemical compound with the molecular formula C6H11ClF3NO and a molecular weight of 205.60 g/mol. IUPAC name: trans-(1S,3R)-3-amino-1-(trifluoromethyl)cyclopentan-1-ol;hydrochloride. InChIKey: TYTZANNWKOWQOQ-JBUOLDKXSA-N.
| Molecular formula | C6H11ClF3NO |
|---|---|
| Molecular weight | 205.60 g/mol |
| IUPAC name | trans-(1S,3R)-3-amino-1-(trifluoromethyl)cyclopentan-1-ol;hydrochloride |
| InChIKey | TYTZANNWKOWQOQ-JBUOLDKXSA-N |
| SMILES | C1C[C@](C[C@@H]1N)(C(F)(F)F)O.Cl |
Computed by PubChem (NCBI)