Products 2230058-95-2

CAS 2230058-95-2 is the registry number for Amisulpride Impurity 57. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-amino-2-methoxy-5-sulfanylbenzoate (CAS 2230058-95-2) is a chemical compound with the molecular formula C9H11NO3S and a molecular weight of 213.26 g/mol. IUPAC name: methyl 4-amino-2-methoxy-5-sulfanylbenzoate. InChIKey: DJUMEJHXQJBDPU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO3S
Molecular weight213.26 g/mol
IUPAC namemethyl 4-amino-2-methoxy-5-sulfanylbenzoate
InChIKeyDJUMEJHXQJBDPU-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)OC)S)N

Computed by PubChem (NCBI)