Products 2230799-90-1
CAS 2230799-90-1 is the registry number for rac-2-Methoxy-N-((3R,4S)-4-(1-methyl-1H-pyrazol-5-yl)pyrrolidin-3-yl)acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-methoxy-N-[(3S,4R)-4-(2-methylpyrazol-3-yl)pyrrolidin-3-yl]acetamide (CAS 2230799-90-1) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: 2-methoxy-N-[(3S,4R)-4-(2-methylpyrazol-3-yl)pyrrolidin-3-yl]acetamide. InChIKey: JOQQTCLOLRPIHC-RKDXNWHRSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | 2-methoxy-N-[(3S,4R)-4-(2-methylpyrazol-3-yl)pyrrolidin-3-yl]acetamide |
| InChIKey | JOQQTCLOLRPIHC-RKDXNWHRSA-N |
| SMILES | CN1C(=CC=N1)[C@@H]2CNC[C@H]2NC(=O)COC |
Computed by PubChem (NCBI)