CAS 2230802-40-9 is the registry number for Rel-methyl (2R)-2-amino-4,4-difluorobutanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 10mg, 0,1g.
Methyl (2R)-2-amino-4,4-difluorobutanoate;hydrochloride (CAS 2230802-40-9) is a chemical compound with the molecular formula C5H10ClF2NO2 and a molecular weight of 189.59 g/mol. IUPAC name: methyl (2R)-2-amino-4,4-difluorobutanoate;hydrochloride. InChIKey: LTLMGMDHRNVCAJ-AENDTGMFSA-N.
| Molecular formula | C5H10ClF2NO2 |
|---|---|
| Molecular weight | 189.59 g/mol |
| IUPAC name | methyl (2R)-2-amino-4,4-difluorobutanoate;hydrochloride |
| InChIKey | LTLMGMDHRNVCAJ-AENDTGMFSA-N |
| SMILES | COC(=O)[C@@H](CC(F)F)N.Cl |
Computed by PubChem (NCBI)