Products 2241127-81-9

CAS 2241127-81-9 is the registry number for 2-Amino-4,4-difluoropentanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-amino-4,4-difluoropentanoic acid;hydrochloride (CAS 2241127-81-9) is a chemical compound with the molecular formula C5H10ClF2NO2 and a molecular weight of 189.59 g/mol. IUPAC name: 2-amino-4,4-difluoropentanoic acid;hydrochloride. InChIKey: AAHBHFNOWUKJKM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H10ClF2NO2
Molecular weight189.59 g/mol
IUPAC name2-amino-4,4-difluoropentanoic acid;hydrochloride
InChIKeyAAHBHFNOWUKJKM-UHFFFAOYSA-N
SMILESCC(CC(C(=O)O)N)(F)F.Cl

Computed by PubChem (NCBI)