Products 2230802-75-0

CAS 2230802-75-0 is the registry number for 9-tert-Butyl 1-ethyl 4-oxo-3,9-diazaspiro(5.5)undecane-1,9-dicarboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

9-O-tert-butyl 5-O-ethyl 2-oxo-3,9-diazaspiro[5.5]undecane-5,9-dicarboxylate (CAS 2230802-75-0) is a chemical compound with the molecular formula C17H28N2O5 and a molecular weight of 340.4 g/mol. IUPAC name: 9-O-tert-butyl 5-O-ethyl 2-oxo-3,9-diazaspiro[5.5]undecane-5,9-dicarboxylate. InChIKey: YJNUCKAYYCEEQC-UHFFFAOYSA-N.

Identity
Molecular formulaC17H28N2O5
Molecular weight340.4 g/mol
IUPAC name9-O-tert-butyl 5-O-ethyl 2-oxo-3,9-diazaspiro[5.5]undecane-5,9-dicarboxylate
InChIKeyYJNUCKAYYCEEQC-UHFFFAOYSA-N
SMILESCCOC(=O)C1CNC(=O)CC12CCN(CC2)C(=O)OC(C)(C)C

Computed by PubChem (NCBI)