Products 2230802-95-4
CAS 2230802-95-4 is the registry number for 2-(Cyclopentylamino)-2,3-dihydro-1H-indene-2-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(cyclopentylamino)-1,3-dihydroindene-2-carboxylic acid;hydrochloride (CAS 2230802-95-4) is a chemical compound with the molecular formula C15H20ClNO2 and a molecular weight of 281.78 g/mol. IUPAC name: 2-(cyclopentylamino)-1,3-dihydroindene-2-carboxylic acid;hydrochloride. InChIKey: WTNZVTWXNUSMKQ-UHFFFAOYSA-N.
| Molecular formula | C15H20ClNO2 |
|---|---|
| Molecular weight | 281.78 g/mol |
| IUPAC name | 2-(cyclopentylamino)-1,3-dihydroindene-2-carboxylic acid;hydrochloride |
| InChIKey | WTNZVTWXNUSMKQ-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2(CC3=CC=CC=C3C2)C(=O)O.Cl |
Computed by PubChem (NCBI)