CAS 2230803-33-3 is the registry number for N,N-Dimethyl-4-azaspiro(2.5)octan-7-amine dihydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N,N-dimethyl-4-azaspiro[2.5]octan-7-amine;dihydrochloride (CAS 2230803-33-3) is a chemical compound with the molecular formula C9H20Cl2N2 and a molecular weight of 227.17 g/mol. IUPAC name: N,N-dimethyl-4-azaspiro[2.5]octan-7-amine;dihydrochloride. InChIKey: AGYXNVYMENFUAQ-UHFFFAOYSA-N.
| Molecular formula | C9H20Cl2N2 |
|---|---|
| Molecular weight | 227.17 g/mol |
| IUPAC name | N,N-dimethyl-4-azaspiro[2.5]octan-7-amine;dihydrochloride |
| InChIKey | AGYXNVYMENFUAQ-UHFFFAOYSA-N |
| SMILES | CN(C)C1CCNC2(C1)CC2.Cl.Cl |
Computed by PubChem (NCBI)