Products 2230803-87-7
CAS 2230803-87-7 is the registry number for tert-Butyl 3-(4-(aminomethyl)phenyl)-2,2-dimethylpropanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Tert-butyl 3-[4-(aminomethyl)phenyl]-2,2-dimethylpropanoate (CAS 2230803-87-7) is a chemical compound with the molecular formula C16H25NO2 and a molecular weight of 263.37 g/mol. IUPAC name: tert-butyl 3-[4-(aminomethyl)phenyl]-2,2-dimethylpropanoate. InChIKey: UJOQFLQYYDTKTE-UHFFFAOYSA-N.
| Molecular formula | C16H25NO2 |
|---|---|
| Molecular weight | 263.37 g/mol |
| IUPAC name | tert-butyl 3-[4-(aminomethyl)phenyl]-2,2-dimethylpropanoate |
| InChIKey | UJOQFLQYYDTKTE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(C)(C)CC1=CC=C(C=C1)CN |
Computed by PubChem (NCBI)