Products 2230807-74-4
CAS 2230807-74-4 is the registry number for rac-(3aR,8aS)-7,7-Dimethyl-octahydro-2H-furo(3,2-c)azepine hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(3aS,8aR)-7,7-dimethyl-2,3,3a,4,5,6,8,8a-octahydrofuro[3,2-c]azepine;hydrochloride (CAS 2230807-74-4) is a chemical compound with the molecular formula C10H20ClNO and a molecular weight of 205.72 g/mol. IUPAC name: (3aS,8aR)-7,7-dimethyl-2,3,3a,4,5,6,8,8a-octahydrofuro[3,2-c]azepine;hydrochloride. InChIKey: OLCPYIIBUOBMPK-OULXEKPRSA-N.
| Molecular formula | C10H20ClNO |
|---|---|
| Molecular weight | 205.72 g/mol |
| IUPAC name | (3aS,8aR)-7,7-dimethyl-2,3,3a,4,5,6,8,8a-octahydrofuro[3,2-c]azepine;hydrochloride |
| InChIKey | OLCPYIIBUOBMPK-OULXEKPRSA-N |
| SMILES | CC1(C[C@@H]2[C@@H](CCO2)CNC1)C.Cl |
Computed by PubChem (NCBI)