CAS 2231122-95-3 is the registry number for 2-(1,1-Difluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(1,1-difluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2231122-95-3) is a chemical compound with the molecular formula C13H18BF2NO2 and a molecular weight of 269.10 g/mol. IUPAC name: 2-(1,1-difluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: NRQUNEPNWSUSEX-UHFFFAOYSA-N.
| Molecular formula | C13H18BF2NO2 |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | 2-(1,1-difluoroethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | NRQUNEPNWSUSEX-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)C(C)(F)F |
Computed by PubChem (NCBI)