CAS 2246367-90-6 is the registry number for 4-(1,1-Difluoroethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(1,1-difluoroethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2246367-90-6) is a chemical compound with the molecular formula C13H18BF2NO2 and a molecular weight of 269.10 g/mol. IUPAC name: 4-(1,1-difluoroethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: FNVBYIAMSSFNCY-UHFFFAOYSA-N.
| Molecular formula | C13H18BF2NO2 |
|---|---|
| Molecular weight | 269.10 g/mol |
| IUPAC name | 4-(1,1-difluoroethyl)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | FNVBYIAMSSFNCY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2)C(C)(F)F |
Computed by PubChem (NCBI)