Products 223123-63-5

CAS 223123-63-5 is the registry number for 4-(2,2-Dicarboethoxy-propyl)phenylacetic Acid Ethyl Ester. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.

Structural formula: {0} (CAS {1})

Diethyl 2-[[4-(2-ethoxy-2-oxoethyl)phenyl]methyl]-2-methylpropanedioate (CAS 223123-63-5) is a chemical compound with the molecular formula C19H26O6 and a molecular weight of 350.4 g/mol. IUPAC name: diethyl 2-[[4-(2-ethoxy-2-oxoethyl)phenyl]methyl]-2-methylpropanedioate. InChIKey: AIAVVZYCFNHAQF-UHFFFAOYSA-N.

Identity
Molecular formulaC19H26O6
Molecular weight350.4 g/mol
IUPAC namediethyl 2-[[4-(2-ethoxy-2-oxoethyl)phenyl]methyl]-2-methylpropanedioate
InChIKeyAIAVVZYCFNHAQF-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CC=C(C=C1)CC(C)(C(=O)OCC)C(=O)OCC

Computed by PubChem (NCBI)