Products 677291-51-9
CAS 677291-51-9 is the registry number for Eurycomalide A. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg.
8,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadec-4-ene-3,15-dione (CAS 677291-51-9) is a chemical compound with the molecular formula C19H26O6 and a molecular weight of 350.4 g/mol. IUPAC name: 8,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadec-4-ene-3,15-dione. InChIKey: ROIUBSDBUACGGP-UHFFFAOYSA-N.
| Molecular formula | C19H26O6 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 8,9,12-trihydroxy-2,6,10,16-tetramethyl-14-oxatetracyclo[11.2.1.02,11.05,10]hexadec-4-ene-3,15-dione |
| InChIKey | ROIUBSDBUACGGP-UHFFFAOYSA-N |
| SMILES | CC1CC(C(C2(C1=CC(=O)C3(C2C(C4C(C3C(=O)O4)C)O)C)C)O)O |
Computed by PubChem (NCBI)
Synonyms:
eurycomalide A