Products 2231345-24-5
CAS 2231345-24-5 is the registry number for 2-(1H-Indole-3-carbonyl)thiazole-4-carboxamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxamide (CAS 2231345-24-5) is a chemical compound with the molecular formula C13H9N3O2S and a molecular weight of 271.30 g/mol. IUPAC name: 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxamide. InChIKey: JKSUDCZUCBZKQS-UHFFFAOYSA-N.
| Molecular formula | C13H9N3O2S |
|---|---|
| Molecular weight | 271.30 g/mol |
| IUPAC name | 2-(1H-indole-3-carbonyl)-1,3-thiazole-4-carboxamide |
| InChIKey | JKSUDCZUCBZKQS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(=O)C3=NC(=CS3)C(=O)N |
Computed by PubChem (NCBI)